C43H60OS — CID 10531991
[(2E,6E,10E,14E,18E)-3,7,11,15,19,23-hexamethyl-1-phenylmethoxytetracosa-2,6,10,14,18,22-hexaen-9-yl]sulfanylbenzene (PubChem CID 10531991) has the molecular formula C43H60OS and a molecular weight of 625.02 g/mol. Its IUPAC name is [(2E,6E,10E,14E,18E)-3,7,11,15,19,23-hexamethyl-1-phenylmethoxytetracosa-2,6,10,14,18,22-hexaen-9-yl]sulfanylbenzene.
| Compound Name | [(2E,6E,10E,14E,18E)-3,7,11,15,19,23-hexamethyl-1-phenylmethoxytetracosa-2,6,10,14,18,22-hexaen-9-yl]sulfanylbenzene |
|---|---|
| PubChem CID | 10531991 |
| Molecular Formula | C43H60OS |
| Molecular Weight | 625.02 g/mol |
| Exact Mass | 624.44 |
| IUPAC Name | [(2E,6E,10E,14E,18E)-3,7,11,15,19,23-hexamethyl-1-phenylmethoxytetracosa-2,6,10,14,18,22-hexaen-9-yl]sulfanylbenzene |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/C(C/C(C)=C/CC/C(C)=C/COCc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C43H60OS/c1-35(2)18-14-19-36(3)20-15-21-37(4)22-16-24-39(6)32-43(45-42-28-12-9-13-29-42)33-40(7)25-17-23-38(5)30-31-44-34-41-26-10-8-11-27-41/h8-13,18,20,22,25-30,32,43H,14-17,19,21,23-24,31,33-34H2,1-7H3/b36-20+,37-22+,38-30+,39-32+,40-25+ |
| InChIKey | RWUSIIQCDDNFAH-BVKBEOOBSA-N |
| XLogP | 13.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.02 |
| LogP ≤ 5 | 13.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|