C30H40OS2 — CID 11070884
(2Z,5E)-2-[4,4-bis(phenylsulfanyl)pentylidene]-6,10-dimethylundeca-5,9-dien-1-ol (PubChem CID 11070884) has the molecular formula C30H40OS2 and a molecular weight of 480.78 g/mol. Its IUPAC name is (2Z,5E)-2-[4,4-bis(phenylsulfanyl)pentylidene]-6,10-dimethylundeca-5,9-dien-1-ol.
| Compound Name | (2Z,5E)-2-[4,4-bis(phenylsulfanyl)pentylidene]-6,10-dimethylundeca-5,9-dien-1-ol |
|---|---|
| PubChem CID | 11070884 |
| Molecular Formula | C30H40OS2 |
| Molecular Weight | 480.78 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | (2Z,5E)-2-[4,4-bis(phenylsulfanyl)pentylidene]-6,10-dimethylundeca-5,9-dien-1-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(=C/CCC(C)(Sc1ccccc1)Sc1ccccc1)CO |
| InChI | InChI=1S/C30H40OS2/c1-25(2)14-11-15-26(3)16-12-17-27(24-31)18-13-23-30(4,32-28-19-7-5-8-20-28)33-29-21-9-6-10-22-29/h5-10,14,16,18-22,31H,11-13,15,17,23-24H2,1-4H3/b26-16+,27-18- |
| InChIKey | GKVILTIBFYENEX-COBSCTLGSA-N |
| XLogP | 9.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.78 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|