C27H39NO2 — CID 70585507
(2E,6E,10E)-N-benzyl-7-(hydroxymethyl)-3,11,15-trimethylhexadeca-2,6,10,14-tetraenamide (PubChem CID 70585507) has the molecular formula C27H39NO2 and a molecular weight of 409.61 g/mol. Its IUPAC name is (2E,6E,10E)-N-benzyl-7-(hydroxymethyl)-3,11,15-trimethylhexadeca-2,6,10,14-tetraenamide.
| Compound Name | (2E,6E,10E)-N-benzyl-7-(hydroxymethyl)-3,11,15-trimethylhexadeca-2,6,10,14-tetraenamide |
|---|---|
| PubChem CID | 70585507 |
| Molecular Formula | C27H39NO2 |
| Molecular Weight | 409.61 g/mol |
| Exact Mass | 409.30 |
| IUPAC Name | (2E,6E,10E)-N-benzyl-7-(hydroxymethyl)-3,11,15-trimethylhexadeca-2,6,10,14-tetraenamide |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(=C\CC/C(C)=C/C(=O)NCc1ccccc1)CO |
| InChI | InChI=1S/C27H39NO2/c1-22(2)11-8-12-23(3)13-9-17-26(21-29)18-10-14-24(4)19-27(30)28-20-25-15-6-5-7-16-25/h5-7,11,13,15-16,18-19,29H,8-10,12,14,17,20-21H2,1-4H3,(H,28,30)/b23-13+,24-19+,26-18+ |
| InChIKey | HKMRDBMFEMLMJA-CRLSLUHGSA-N |
| XLogP | 6.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.61 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|