C21H29N3O2 — CID 3317307
N-benzyl-N'-(3,7-dimethylocta-2,6-dienylideneamino)butanediamide (PubChem CID 3317307) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is N-benzyl-N'-(3,7-dimethylocta-2,6-dienylideneamino)butanediamide.
| Compound Name | N-benzyl-N'-(3,7-dimethylocta-2,6-dienylideneamino)butanediamide |
|---|---|
| PubChem CID | 3317307 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | N-benzyl-N'-(3,7-dimethylocta-2,6-dienylideneamino)butanediamide |
| SMILES | CC(C)=CCCC(C)=CC=NNC(=O)CCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C21H29N3O2/c1-17(2)8-7-9-18(3)14-15-23-24-21(26)13-12-20(25)22-16-19-10-5-4-6-11-19/h4-6,8,10-11,14-15H,7,9,12-13,16H2,1-3H3,(H,22,25)(H,24,26) |
| InChIKey | ZIHNTVUVNKLWNC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|