C20H26N2O — CID 3098185
N-(3,7-dimethylocta-2,6-dienylideneamino)-2-phenylcyclopropane-1-carboxamide (PubChem CID 3098185) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is N-(3,7-dimethylocta-2,6-dienylideneamino)-2-phenylcyclopropane-1-carboxamide.
| Compound Name | N-(3,7-dimethylocta-2,6-dienylideneamino)-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 3098185 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | N-(3,7-dimethylocta-2,6-dienylideneamino)-2-phenylcyclopropane-1-carboxamide |
| SMILES | CC(C)=CCCC(C)=CC=NNC(=O)C1CC1c1ccccc1 |
| InChI | InChI=1S/C20H26N2O/c1-15(2)8-7-9-16(3)12-13-21-22-20(23)19-14-18(19)17-10-5-4-6-11-17/h4-6,8,10-13,18-19H,7,9,14H2,1-3H3,(H,22,23) |
| InChIKey | LJARHXKXELULFY-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|