C15H18N2O — CID 7203116
trans-(1S,2S)-N-[(E)-1-cyclopropylethylideneamino]-2-phenylcyclopropane-1-carboxamide (PubChem CID 7203116) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is trans-(1S,2S)-N-[(E)-1-cyclopropylethylideneamino]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-N-[(E)-1-cyclopropylethylideneamino]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 7203116 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | trans-(1S,2S)-N-[(E)-1-cyclopropylethylideneamino]-2-phenylcyclopropane-1-carboxamide |
| SMILES | C/C(=N\NC(=O)[C@H]1C[C@@H]1c1ccccc1)C1CC1 |
| InChI | InChI=1S/C15H18N2O/c1-10(11-7-8-11)16-17-15(18)14-9-13(14)12-5-3-2-4-6-12/h2-6,11,13-14H,7-9H2,1H3,(H,17,18)/b16-10+/t13-,14+/m1/s1 |
| InChIKey | XXFCTZAFEIRUJB-OACWRPJVSA-N |
| XLogP | 2.69 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|