C19H20N2O — CID 904155
trans-(1R,2R)-2-phenyl-N-(1-phenylpropylideneamino)cyclopropane-1-carboxamide (PubChem CID 904155) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is trans-(1R,2R)-2-phenyl-N-(1-phenylpropylideneamino)cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-2-phenyl-N-(1-phenylpropylideneamino)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 904155 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | trans-(1R,2R)-2-phenyl-N-(1-phenylpropylideneamino)cyclopropane-1-carboxamide |
| SMILES | CCC(=NNC(=O)[C@@H]1C[C@H]1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H20N2O/c1-2-18(15-11-7-4-8-12-15)20-21-19(22)17-13-16(17)14-9-5-3-6-10-14/h3-12,16-17H,2,13H2,1H3,(H,21,22)/t16-,17+/m0/s1 |
| InChIKey | XFJWPTFFMXCMNW-DLBZAZTESA-N |
| XLogP | 3.72 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|