C16H16N2OS — CID 40528188
cis-(1R,2S)-N-[(Z)-(5-methylthiophen-2-yl)methylideneamino]-2-phenylcyclopropane-1-carboxamide (PubChem CID 40528188) has the molecular formula C16H16N2OS and a molecular weight of 284.38 g/mol. Its IUPAC name is cis-(1R,2S)-N-[(Z)-(5-methylthiophen-2-yl)methylideneamino]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2S)-N-[(Z)-(5-methylthiophen-2-yl)methylideneamino]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 40528188 |
| Molecular Formula | C16H16N2OS |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | cis-(1R,2S)-N-[(Z)-(5-methylthiophen-2-yl)methylideneamino]-2-phenylcyclopropane-1-carboxamide |
| SMILES | Cc1ccc(/C=N\NC(=O)[C@@H]2C[C@@H]2c2ccccc2)s1 |
| InChI | InChI=1S/C16H16N2OS/c1-11-7-8-13(20-11)10-17-18-16(19)15-9-14(15)12-5-3-2-4-6-12/h2-8,10,14-15H,9H2,1H3,(H,18,19)/b17-10-/t14-,15-/m1/s1 |
| InChIKey | CEPUGCPSSYIKGY-IGIWSDCRSA-N |
| XLogP | 3.31 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|