C16H22S2 — CID 87471921
[[(2E)-3,7-dimethylocta-2,6-dienyl]disulfanyl]benzene (PubChem CID 87471921) has the molecular formula C16H22S2 and a molecular weight of 278.49 g/mol. Its IUPAC name is [[(2E)-3,7-dimethylocta-2,6-dienyl]disulfanyl]benzene.
| Compound Name | [[(2E)-3,7-dimethylocta-2,6-dienyl]disulfanyl]benzene |
|---|---|
| PubChem CID | 87471921 |
| Molecular Formula | C16H22S2 |
| Molecular Weight | 278.49 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | [[(2E)-3,7-dimethylocta-2,6-dienyl]disulfanyl]benzene |
| SMILES | CC(C)=CCC/C(C)=C/CSSc1ccccc1 |
| InChI | InChI=1S/C16H22S2/c1-14(2)8-7-9-15(3)12-13-17-18-16-10-5-4-6-11-16/h4-6,8,10-12H,7,9,13H2,1-3H3/b15-12+ |
| InChIKey | JGQBBWLOAZQEEL-NTCAYCPXSA-N |
| XLogP | 6.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.49 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|