C22H27PS — CID 101370952
[(2E)-3,7-dimethylocta-2,6-dienyl]-diphenyl-sulfanylidene-λ5-phosphane (PubChem CID 101370952) has the molecular formula C22H27PS and a molecular weight of 354.50 g/mol. Its IUPAC name is [(2E)-3,7-dimethylocta-2,6-dienyl]-diphenyl-sulfanylidene-λ5-phosphane.
| Compound Name | [(2E)-3,7-dimethylocta-2,6-dienyl]-diphenyl-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 101370952 |
| Molecular Formula | C22H27PS |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | [(2E)-3,7-dimethylocta-2,6-dienyl]-diphenyl-sulfanylidene-λ5-phosphane |
| SMILES | CC(C)=CCC/C(C)=C/CP(=S)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H27PS/c1-19(2)11-10-12-20(3)17-18-23(24,21-13-6-4-7-14-21)22-15-8-5-9-16-22/h4-9,11,13-17H,10,12,18H2,1-3H3/b20-17+ |
| InChIKey | YNFDJYORWMLILX-LVZFUZTISA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|