C9H11IO2 — CID 25215299
4-[(Z)-4-iodo-3-methylbut-3-enyl]-2H-furan-5-one (PubChem CID 25215299) has the molecular formula C9H11IO2 and a molecular weight of 278.09 g/mol. Its IUPAC name is 4-[(Z)-4-iodo-3-methylbut-3-enyl]-2H-furan-5-one.
| Compound Name | 4-[(Z)-4-iodo-3-methylbut-3-enyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 25215299 |
| Molecular Formula | C9H11IO2 |
| Molecular Weight | 278.09 g/mol |
| Exact Mass | 277.98 |
| IUPAC Name | 4-[(Z)-4-iodo-3-methylbut-3-enyl]-2H-furan-5-one |
| SMILES | C/C(=C/I)CCC1=CCOC1=O |
| InChI | InChI=1S/C9H11IO2/c1-7(6-10)2-3-8-4-5-12-9(8)11/h4,6H,2-3,5H2,1H3/b7-6- |
| InChIKey | YVHGQZCGUKIQRD-SREVYHEPSA-N |
| XLogP | 2.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.09 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|