C32H37FOSe — CID 10578259
Se-phenyl (5E,9Z,13E)-9-fluoro-5,13-dimethyl-18-phenyloctadeca-5,9,13-trien-17-yneselenoate (PubChem CID 10578259) has the molecular formula C32H37FOSe and a molecular weight of 535.61 g/mol. Its IUPAC name is Se-phenyl (5E,9Z,13E)-9-fluoro-5,13-dimethyl-18-phenyloctadeca-5,9,13-trien-17-yneselenoate.
| Compound Name | Se-phenyl (5E,9Z,13E)-9-fluoro-5,13-dimethyl-18-phenyloctadeca-5,9,13-trien-17-yneselenoate |
|---|---|
| PubChem CID | 10578259 |
| Molecular Formula | C32H37FOSe |
| Molecular Weight | 535.61 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | Se-phenyl (5E,9Z,13E)-9-fluoro-5,13-dimethyl-18-phenyloctadeca-5,9,13-trien-17-yneselenoate |
| SMILES | C/C(=C\CCC#Cc1ccccc1)CC/C=C(\F)CC/C=C(\C)CCCC(=O)[Se]c1ccccc1 |
| InChI | InChI=1S/C32H37FOSe/c1-27(15-6-3-7-19-29-20-8-4-9-21-29)16-12-22-30(33)23-13-17-28(2)18-14-26-32(34)35-31-24-10-5-11-25-31/h4-5,8-11,15,17,20-22,24-25H,3,6,12-14,16,18,23,26H2,1-2H3/b27-15+,28-17+,30-22- |
| InChIKey | AIDFVTUQKJXXBN-HDCMQMRZSA-N |
| XLogP | 7.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.61 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|