C17H20BrNO — CID 54064104
2-bromo-N-(2-methylpropyl)-7-phenylhept-2-en-6-ynamide (PubChem CID 54064104) has the molecular formula C17H20BrNO and a molecular weight of 334.26 g/mol. Its IUPAC name is 2-bromo-N-(2-methylpropyl)-7-phenylhept-2-en-6-ynamide.
| Compound Name | 2-bromo-N-(2-methylpropyl)-7-phenylhept-2-en-6-ynamide |
|---|---|
| PubChem CID | 54064104 |
| Molecular Formula | C17H20BrNO |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 2-bromo-N-(2-methylpropyl)-7-phenylhept-2-en-6-ynamide |
| SMILES | CC(C)CNC(=O)C(Br)=CCCC#Cc1ccccc1 |
| InChI | InChI=1S/C17H20BrNO/c1-14(2)13-19-17(20)16(18)12-8-4-7-11-15-9-5-3-6-10-15/h3,5-6,9-10,12,14H,4,8,13H2,1-2H3,(H,19,20) |
| InChIKey | MBTBCJCXHOXNDT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|