C19H23NO — CID 88613799
(2E,8E)-N-(2-methylpropyl)-9-phenylnona-2,8-dien-6-ynamide (PubChem CID 88613799) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is (2E,8E)-N-(2-methylpropyl)-9-phenylnona-2,8-dien-6-ynamide.
| Compound Name | (2E,8E)-N-(2-methylpropyl)-9-phenylnona-2,8-dien-6-ynamide |
|---|---|
| PubChem CID | 88613799 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | (2E,8E)-N-(2-methylpropyl)-9-phenylnona-2,8-dien-6-ynamide |
| SMILES | CC(C)CNC(=O)/C=C/CCC#C/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H23NO/c1-17(2)16-20-19(21)15-11-6-4-3-5-8-12-18-13-9-7-10-14-18/h7-15,17H,4,6,16H2,1-2H3,(H,20,21)/b12-8+,15-11+ |
| InChIKey | FAQUSANMOJHTRH-HRVWGNOLSA-N |
| XLogP | 3.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|