C27H35FO2 — CID 10597707
ethyl (4E,8Z,12E)-8-fluoro-4,12-dimethyl-17-phenylheptadeca-4,8,12-trien-16-ynoate (PubChem CID 10597707) has the molecular formula C27H35FO2 and a molecular weight of 410.57 g/mol. Its IUPAC name is ethyl (4E,8Z,12E)-8-fluoro-4,12-dimethyl-17-phenylheptadeca-4,8,12-trien-16-ynoate.
| Compound Name | ethyl (4E,8Z,12E)-8-fluoro-4,12-dimethyl-17-phenylheptadeca-4,8,12-trien-16-ynoate |
|---|---|
| PubChem CID | 10597707 |
| Molecular Formula | C27H35FO2 |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | ethyl (4E,8Z,12E)-8-fluoro-4,12-dimethyl-17-phenylheptadeca-4,8,12-trien-16-ynoate |
| SMILES | CCOC(=O)CC/C(C)=C/CC/C(F)=C/CC/C(C)=C/CCC#Cc1ccccc1 |
| InChI | InChI=1S/C27H35FO2/c1-4-30-27(29)22-21-24(3)15-12-20-26(28)19-11-14-23(2)13-7-5-8-16-25-17-9-6-10-18-25/h6,9-10,13,15,17-19H,4-5,7,11-12,14,20-22H2,1-3H3/b23-13+,24-15+,26-19- |
| InChIKey | KAZHHNQDDDUABZ-FHQOJRKOSA-N |
| XLogP | 7.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|