C31H44O3SeSi — CID 10578977
methyl (2E,6E)-6-methyl-2-[(E)-4-methyl-8-oxo-8-phenylselanyloct-3-enyl]-11-trimethylsilylundeca-2,6-dien-10-ynoate (PubChem CID 10578977) has the molecular formula C31H44O3SeSi and a molecular weight of 571.74 g/mol. Its IUPAC name is methyl (2E,6E)-6-methyl-2-[(E)-4-methyl-8-oxo-8-phenylselanyloct-3-enyl]-11-trimethylsilylundeca-2,6-dien-10-ynoate.
| Compound Name | methyl (2E,6E)-6-methyl-2-[(E)-4-methyl-8-oxo-8-phenylselanyloct-3-enyl]-11-trimethylsilylundeca-2,6-dien-10-ynoate |
|---|---|
| PubChem CID | 10578977 |
| Molecular Formula | C31H44O3SeSi |
| Molecular Weight | 571.74 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | methyl (2E,6E)-6-methyl-2-[(E)-4-methyl-8-oxo-8-phenylselanyloct-3-enyl]-11-trimethylsilylundeca-2,6-dien-10-ynoate |
| SMILES | COC(=O)/C(=C/CC/C(C)=C/CCC#C[Si](C)(C)C)CC/C=C(\C)CCCC(=O)[Se]c1ccccc1 |
| InChI | InChI=1S/C31H44O3SeSi/c1-26(16-9-8-12-25-36(4,5)6)17-13-20-28(31(33)34-3)21-14-18-27(2)19-15-24-30(32)35-29-22-10-7-11-23-29/h7,10-11,16,18,20,22-23H,8-9,13-15,17,19,21,24H2,1-6H3/b26-16+,27-18+,28-20+ |
| InChIKey | FRJNZZZJHWKGAO-AYLKDXQSSA-N |
| XLogP | 6.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.74 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|