C22H30O2S — CID 156720953
[(8E)-9,13-dimethyltetradeca-8,12-dien-4-yn-2-yl]sulfonylbenzene (PubChem CID 156720953) has the molecular formula C22H30O2S and a molecular weight of 358.55 g/mol. Its IUPAC name is [(8E)-9,13-dimethyltetradeca-8,12-dien-4-yn-2-yl]sulfonylbenzene.
| Compound Name | [(8E)-9,13-dimethyltetradeca-8,12-dien-4-yn-2-yl]sulfonylbenzene |
|---|---|
| PubChem CID | 156720953 |
| Molecular Formula | C22H30O2S |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | [(8E)-9,13-dimethyltetradeca-8,12-dien-4-yn-2-yl]sulfonylbenzene |
| SMILES | CC(C)=CCC/C(C)=C/CCC#CCC(C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H30O2S/c1-19(2)13-12-15-20(3)14-8-5-6-9-16-21(4)25(23,24)22-17-10-7-11-18-22/h7,10-11,13-14,17-18,21H,5,8,12,15-16H2,1-4H3/b20-14+ |
| InChIKey | SLNPYVIRCAUZGU-XSFVSMFZSA-N |
| XLogP | 5.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|