C14H22O — CID 11830599
(6E)-7,11-dimethyldodeca-6,10-dien-2-yn-1-ol (PubChem CID 11830599) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is (6E)-7,11-dimethyldodeca-6,10-dien-2-yn-1-ol.
| Compound Name | (6E)-7,11-dimethyldodeca-6,10-dien-2-yn-1-ol |
|---|---|
| PubChem CID | 11830599 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | (6E)-7,11-dimethyldodeca-6,10-dien-2-yn-1-ol |
| SMILES | CC(C)=CCC/C(C)=C/CCC#CCO |
| InChI | InChI=1S/C14H22O/c1-13(2)9-8-11-14(3)10-6-4-5-7-12-15/h9-10,15H,4,6,8,11-12H2,1-3H3/b14-10+ |
| InChIKey | SVNPXCFLXBYXIJ-GXDHUFHOSA-N |
| XLogP | 3.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|