C21H22O3SSe — CID 14616954
Se-phenyl 4-[2-[(E)-2-phenylsulfanylethenyl]-1,3-dioxolan-2-yl]butaneselenoate (PubChem CID 14616954) has the molecular formula C21H22O3SSe and a molecular weight of 433.43 g/mol. Its IUPAC name is Se-phenyl 4-[2-[(E)-2-phenylsulfanylethenyl]-1,3-dioxolan-2-yl]butaneselenoate.
| Compound Name | Se-phenyl 4-[2-[(E)-2-phenylsulfanylethenyl]-1,3-dioxolan-2-yl]butaneselenoate |
|---|---|
| PubChem CID | 14616954 |
| Molecular Formula | C21H22O3SSe |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | Se-phenyl 4-[2-[(E)-2-phenylsulfanylethenyl]-1,3-dioxolan-2-yl]butaneselenoate |
| SMILES | O=C(CCCC1(/C=C/Sc2ccccc2)OCCO1)[Se]c1ccccc1 |
| InChI | InChI=1S/C21H22O3SSe/c22-20(26-19-10-5-2-6-11-19)12-7-13-21(23-15-16-24-21)14-17-25-18-8-3-1-4-9-18/h1-6,8-11,14,17H,7,12-13,15-16H2/b17-14+ |
| InChIKey | ITESLCARXWLNMR-SAPNQHFASA-N |
| XLogP | 3.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|