4-(6-phenyl-1,4-dioxaspiro[4.5]decan-6-yl)butanoic acid

C18H24O4 — CID 66692629

IUPAC4-(6-phenyl-1,4-dioxaspiro[4.5]decan-6-yl)butanoic acid
SMILESO=C(O)CCCC1(c2ccccc2)CCCCC12OCCO2
InChIInChI=1S/C18H24O4/c19-16(20)9-6-11-17(15-7-2-1-3-8-15)10-4-5-12-18(17)21-13-14-22-18/h1-3,7-8H,4-6,9-14H2,(H,19,20)
InChIKeyJJANVACNXACNKR-UHFFFAOYSA-N
MW304.39 g/mol
LogP3.50
Rot. Bonds5

About 4-(6-phenyl-1,4-dioxaspiro[4.5]decan-6-yl)butanoic acid

4-(6-phenyl-1,4-dioxaspiro[4.5]decan-6-yl)butanoic acid (PubChem CID 66692629) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is 4-(6-phenyl-1,4-dioxaspiro[4.5]decan-6-yl)butanoic acid.

Molecular Properties

Compound Name4-(6-phenyl-1,4-dioxaspiro[4.5]decan-6-yl)butanoic acid
PubChem CID66692629
Molecular FormulaC18H24O4
Molecular Weight304.39 g/mol
Exact Mass304.17
IUPAC Name4-(6-phenyl-1,4-dioxaspiro[4.5]decan-6-yl)butanoic acid
SMILESO=C(O)CCCC1(c2ccccc2)CCCCC12OCCO2
InChIInChI=1S/C18H24O4/c19-16(20)9-6-11-17(15-7-2-1-3-8-15)10-4-5-12-18(17)21-13-14-22-18/h1-3,7-8H,4-6,9-14H2,(H,19,20)
InChIKeyJJANVACNXACNKR-UHFFFAOYSA-N
XLogP3.50
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500304.39
LogP ≤ 53.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-(6-phenyl-1,4-dioxaspiro[4.5]decan-6-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(6-phenyl-1,4-dioxaspiro[4.5]decan-6-yl)butanoic acid?
The IUPAC name of 4-(6-phenyl-1,4-dioxaspiro[4.5]decan-6-yl)butanoic acid (CID 66692629) is 4-(6-phenyl-1,4-dioxaspiro[4.5]decan-6-yl)butanoic acid.
What is the SMILES notation for 4-(6-phenyl-1,4-dioxaspiro[4.5]decan-6-yl)butanoic acid?
The canonical SMILES for 4-(6-phenyl-1,4-dioxaspiro[4.5]decan-6-yl)butanoic acid is O=C(O)CCCC1(c2ccccc2)CCCCC12OCCO2.
What is the InChIKey of 4-(6-phenyl-1,4-dioxaspiro[4.5]decan-6-yl)butanoic acid?
The InChIKey is JJANVACNXACNKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24O4/c19-16(20)9-6-11-17(15-7-2-1-3-8-15)10-4-5-12-18(17)21-13-14-22-18/h1-3,7-8H,4-6,9-14H2,(H,19,20).
What are the key properties of 4-(6-phenyl-1,4-dioxaspiro[4.5]decan-6-yl)butanoic acid?
4-(6-phenyl-1,4-dioxaspiro[4.5]decan-6-yl)butanoic acid has a molecular weight of 304.39 g/mol, XLogP of 3.50, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-phenyl-1,4-dioxaspiro[4.5]decan-6-yl)butanoic acid is sourced from PubChem (CID 66692629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).