C16H20O5 — CID 102348374
[(1S,2R,4S,5S)-5-phenylspiro[3,6,8-trioxabicyclo[3.2.1]octane-4,2'-oxane]-2-yl]methanol (PubChem CID 102348374) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is [(1S,2R,4S,5S)-5-phenylspiro[3,6,8-trioxabicyclo[3.2.1]octane-4,2'-oxane]-2-yl]methanol.
| Compound Name | [(1S,2R,4S,5S)-5-phenylspiro[3,6,8-trioxabicyclo[3.2.1]octane-4,2'-oxane]-2-yl]methanol |
|---|---|
| PubChem CID | 102348374 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | [(1S,2R,4S,5S)-5-phenylspiro[3,6,8-trioxabicyclo[3.2.1]octane-4,2'-oxane]-2-yl]methanol |
| SMILES | OC[C@H]1O[C@@]2(CCCCO2)[C@@]2(c3ccccc3)OC[C@@H]1O2 |
| InChI | InChI=1S/C16H20O5/c17-10-13-14-11-19-16(21-14,12-6-2-1-3-7-12)15(20-13)8-4-5-9-18-15/h1-3,6-7,13-14,17H,4-5,8-11H2/t13-,14+,15+,16+/m1/s1 |
| InChIKey | KAYRHUZNFPUFEU-UGUYLWEFSA-N |
| XLogP | 1.54 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |