C42H68O11 — CID 66830755
(2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-phenylmethoxy-4-[(2S,3R,4S,5R,6R)-3,4,5-tripentoxy-6-(pentoxymethyl)oxan-2-yl]oxy-2H-furan-5-one (PubChem CID 66830755) has the molecular formula C42H68O11 and a molecular weight of 749.00 g/mol. Its IUPAC name is (2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-phenylmethoxy-4-[(2S,3R,4S,5R,6R)-3,4,5-tripentoxy-6-(pentoxymethyl)oxan-2-yl]oxy-2H-furan-5-one.
| Compound Name | (2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-phenylmethoxy-4-[(2S,3R,4S,5R,6R)-3,4,5-tripentoxy-6-(pentoxymethyl)oxan-2-yl]oxy-2H-furan-5-one |
|---|---|
| PubChem CID | 66830755 |
| Molecular Formula | C42H68O11 |
| Molecular Weight | 749.00 g/mol |
| Exact Mass | 748.48 |
| IUPAC Name | (2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-phenylmethoxy-4-[(2S,3R,4S,5R,6R)-3,4,5-tripentoxy-6-(pentoxymethyl)oxan-2-yl]oxy-2H-furan-5-one |
| SMILES | CCCCCOC[C@H]1O[C@@H](OC2=C(OCc3ccccc3)[C@@H]([C@@H]3COC(C)(C)O3)OC2=O)[C@H](OCCCCC)[C@@H](OCCCCC)[C@@H]1OCCCCC |
| InChI | InChI=1S/C42H68O11/c1-7-11-18-24-44-29-32-34(45-25-19-12-8-2)36(46-26-20-13-9-3)39(47-27-21-14-10-4)41(50-32)52-38-37(48-28-31-22-16-15-17-23-31)35(51-40(38)43)33-30-49-42(5,6)53-33/h15-17,22-23,32-36,39,41H,7-14,18-21,24-30H2,1-6H3/t32-,33+,34-,35-,36+,39-,41+/m1/s1 |
| InChIKey | GZMNJJCOHCBNCS-ZXSWJLPFSA-N |
| XLogP | 8.17 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.00 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|