C12H16Cl3NO5 — CID 102257066
N-[(3aR,5S,6S,6aR)-6-ethenyl-5-(hydroxymethyl)-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl]-2,2,2-trichloroacetamide (PubChem CID 102257066) has the molecular formula C12H16Cl3NO5 and a molecular weight of 360.62 g/mol. Its IUPAC name is N-[(3aR,5S,6S,6aR)-6-ethenyl-5-(hydroxymethyl)-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl]-2,2,2-trichloroacetamide.
| Compound Name | N-[(3aR,5S,6S,6aR)-6-ethenyl-5-(hydroxymethyl)-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 102257066 |
| Molecular Formula | C12H16Cl3NO5 |
| Molecular Weight | 360.62 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | N-[(3aR,5S,6S,6aR)-6-ethenyl-5-(hydroxymethyl)-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl]-2,2,2-trichloroacetamide |
| SMILES | C=C[C@]1(NC(=O)C(Cl)(Cl)Cl)[C@@H](CO)O[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C12H16Cl3NO5/c1-4-11(16-9(18)12(13,14)15)6(5-17)19-8-7(11)20-10(2,3)21-8/h4,6-8,17H,1,5H2,2-3H3,(H,16,18)/t6-,7+,8-,11+/m1/s1 |
| InChIKey | SHCXWUMWWVUSRW-UVMAFCGOSA-N |
| XLogP | 1.27 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.62 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|