C7H10Cl3NO — CID 10681001
2,2,2-trichloro-N-(2-methylbut-3-en-2-yl)acetamide (PubChem CID 10681001) has the molecular formula C7H10Cl3NO and a molecular weight of 230.52 g/mol. Its IUPAC name is 2,2,2-trichloro-N-(2-methylbut-3-en-2-yl)acetamide.
| Compound Name | 2,2,2-trichloro-N-(2-methylbut-3-en-2-yl)acetamide |
|---|---|
| PubChem CID | 10681001 |
| Molecular Formula | C7H10Cl3NO |
| Molecular Weight | 230.52 g/mol |
| Exact Mass | 228.98 |
| IUPAC Name | 2,2,2-trichloro-N-(2-methylbut-3-en-2-yl)acetamide |
| SMILES | C=CC(C)(C)NC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H10Cl3NO/c1-4-6(2,3)11-5(12)7(8,9)10/h4H,1H2,2-3H3,(H,11,12) |
| InChIKey | JYVLCEQCUAZVSI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|