C10H21ClN2O2 — CID 87161067
azane;3-(2-methylbut-3-en-2-ylamino)-2-methylidenebutanoic acid;hydrochloride (PubChem CID 87161067) has the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. Its IUPAC name is azane;3-(2-methylbut-3-en-2-ylamino)-2-methylidenebutanoic acid;hydrochloride.
| Compound Name | azane;3-(2-methylbut-3-en-2-ylamino)-2-methylidenebutanoic acid;hydrochloride |
|---|---|
| PubChem CID | 87161067 |
| Molecular Formula | C10H21ClN2O2 |
| Molecular Weight | 236.74 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | azane;3-(2-methylbut-3-en-2-ylamino)-2-methylidenebutanoic acid;hydrochloride |
| SMILES | C=CC(C)(C)NC(C)C(=C)C(=O)O.Cl.N |
| InChI | InChI=1S/C10H17NO2.ClH.H3N/c1-6-10(4,5)11-8(3)7(2)9(12)13;;/h6,8,11H,1-2H2,3-5H3,(H,12,13);1H;1H3 |
| InChIKey | HSECLFNVRJXEHK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.74 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|