C17H32O8 — CID 161098410
(3aR,5R,6R,6aR)-5-ethyl-2,2,6-trimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-ol;(2S,3R,4S,5R)-5-ethyl-4-methyloxolane-2,3,4-triol (PubChem CID 161098410) has the molecular formula C17H32O8 and a molecular weight of 364.44 g/mol. Its IUPAC name is (3aR,5R,6R,6aR)-5-ethyl-2,2,6-trimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-ol;(2S,3R,4S,5R)-5-ethyl-4-methyloxolane-2,3,4-triol.
| Compound Name | (3aR,5R,6R,6aR)-5-ethyl-2,2,6-trimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-ol;(2S,3R,4S,5R)-5-ethyl-4-methyloxolane-2,3,4-triol |
|---|---|
| PubChem CID | 161098410 |
| Molecular Formula | C17H32O8 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | (3aR,5R,6R,6aR)-5-ethyl-2,2,6-trimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-ol;(2S,3R,4S,5R)-5-ethyl-4-methyloxolane-2,3,4-triol |
| SMILES | CC[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@]1(C)O.CC[C@H]1O[C@H](O)[C@H](O)[C@]1(C)O |
| InChI | InChI=1S/C10H18O4.C7H14O4/c1-5-6-10(4,11)7-8(12-6)14-9(2,3)13-7;1-3-4-7(2,10)5(8)6(9)11-4/h6-8,11H,5H2,1-4H3;4-6,8-10H,3H2,1-2H3/t6-,7+,8-,10-;4-,5+,6+,7-/m11/s1 |
| InChIKey | UICKEJBMHFAHDI-RBFISUCESA-N |
| XLogP | 0.25 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |