C13H20O3 — CID 160577301
(3aR,5R,6S,6aR)-5-ethyl-2,2,6-trimethyl-6-prop-1-ynyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole (PubChem CID 160577301) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-5-ethyl-2,2,6-trimethyl-6-prop-1-ynyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-5-ethyl-2,2,6-trimethyl-6-prop-1-ynyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 160577301 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (3aR,5R,6S,6aR)-5-ethyl-2,2,6-trimethyl-6-prop-1-ynyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole |
| SMILES | CC#C[C@@]1(C)[C@@H](CC)O[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C13H20O3/c1-6-8-13(5)9(7-2)14-11-10(13)15-12(3,4)16-11/h9-11H,7H2,1-5H3/t9-,10+,11-,13+/m1/s1 |
| InChIKey | ZIXBSNFSRYWCGG-XZUYRWCXSA-N |
| XLogP | 2.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|