C16H22Cl3NO10 — CID 101419235
2,2,2-trichloro-N-[(1S,3S,5R,6S,7R,8S,9S,10S)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,8,9,10-tetrahydroxy-9-(hydroxymethyl)-2,4-dioxatricyclo[3.3.1.13,7]decan-7-yl]acetamide (PubChem CID 101419235) has the molecular formula C16H22Cl3NO10 and a molecular weight of 494.71 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[(1S,3S,5R,6S,7R,8S,9S,10S)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,8,9,10-tetrahydroxy-9-(hydroxymethyl)-2,4-dioxatricyclo[3.3.1.13,7]decan-7-yl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[(1S,3S,5R,6S,7R,8S,9S,10S)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,8,9,10-tetrahydroxy-9-(hydroxymethyl)-2,4-dioxatricyclo[3.3.1.13,7]decan-7-yl]acetamide |
|---|---|
| PubChem CID | 101419235 |
| Molecular Formula | C16H22Cl3NO10 |
| Molecular Weight | 494.71 g/mol |
| Exact Mass | 493.03 |
| IUPAC Name | 2,2,2-trichloro-N-[(1S,3S,5R,6S,7R,8S,9S,10S)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,8,9,10-tetrahydroxy-9-(hydroxymethyl)-2,4-dioxatricyclo[3.3.1.13,7]decan-7-yl]acetamide |
| SMILES | CC1(C)OC[C@H]([C@H]2[C@H]3O[C@]4(O)O[C@@H]([C@@H](O)[C@@]2(NC(=O)C(Cl)(Cl)Cl)[C@@H]4O)[C@]3(O)CO)O1 |
| InChI | InChI=1S/C16H22Cl3NO10/c1-12(2)27-3-5(28-12)6-8-13(25,4-21)9-7(22)14(6,20-11(24)15(17,18)19)10(23)16(26,29-8)30-9/h5-10,21-23,25-26H,3-4H2,1-2H3,(H,20,24)/t5-,6+,7-,8-,9+,10+,13+,14-,16+/m1/s1 |
| InChIKey | ORFCQOWPLOBYBV-FFQMDORBSA-N |
| XLogP | -2.12 |
| TPSA | 167.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.71 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|