C8H12Cl3NO4 — CID 11231660
2,2,2-trichloro-N-[[(2R,3R,4R)-3,4-dihydroxy-2-methyloxolan-2-yl]methyl]acetamide (PubChem CID 11231660) has the molecular formula C8H12Cl3NO4 and a molecular weight of 292.55 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[[(2R,3R,4R)-3,4-dihydroxy-2-methyloxolan-2-yl]methyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[[(2R,3R,4R)-3,4-dihydroxy-2-methyloxolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 11231660 |
| Molecular Formula | C8H12Cl3NO4 |
| Molecular Weight | 292.55 g/mol |
| Exact Mass | 290.98 |
| IUPAC Name | 2,2,2-trichloro-N-[[(2R,3R,4R)-3,4-dihydroxy-2-methyloxolan-2-yl]methyl]acetamide |
| SMILES | C[C@]1(CNC(=O)C(Cl)(Cl)Cl)OC[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C8H12Cl3NO4/c1-7(5(14)4(13)2-16-7)3-12-6(15)8(9,10)11/h4-5,13-14H,2-3H2,1H3,(H,12,15)/t4-,5-,7-/m1/s1 |
| InChIKey | NWLDLENODXFOAB-WYDQCIBASA-N |
| XLogP | -0.02 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.55 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|