C10H19NO7 — CID 139088476
2-methyl-2-[[(2R,3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methylamino]propanoic acid (PubChem CID 139088476) has the molecular formula C10H19NO7 and a molecular weight of 265.26 g/mol. Its IUPAC name is 2-methyl-2-[[(2R,3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methylamino]propanoic acid.
| Compound Name | 2-methyl-2-[[(2R,3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 139088476 |
| Molecular Formula | C10H19NO7 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-methyl-2-[[(2R,3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methylamino]propanoic acid |
| SMILES | CC(C)(NC[C@@]1(O)OC[C@@H](O)[C@@H](O)[C@@H]1O)C(=O)O |
| InChI | InChI=1S/C10H19NO7/c1-9(2,8(15)16)11-4-10(17)7(14)6(13)5(12)3-18-10/h5-7,11-14,17H,3-4H2,1-2H3,(H,15,16)/t5-,6-,7+,10-/m1/s1 |
| InChIKey | WGLMGCFGDAAMIR-QGOVLLJGSA-N |
| XLogP | -2.76 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |