C16H25NO5 — CID 11716571
(2R,3S,4R,5R)-2-[(4-tert-butylanilino)methyl]oxane-2,3,4,5-tetrol (PubChem CID 11716571) has the molecular formula C16H25NO5 and a molecular weight of 311.38 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[(4-tert-butylanilino)methyl]oxane-2,3,4,5-tetrol.
| Compound Name | (2R,3S,4R,5R)-2-[(4-tert-butylanilino)methyl]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 11716571 |
| Molecular Formula | C16H25NO5 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | (2R,3S,4R,5R)-2-[(4-tert-butylanilino)methyl]oxane-2,3,4,5-tetrol |
| SMILES | CC(C)(C)c1ccc(NC[C@@]2(O)OC[C@@H](O)[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C16H25NO5/c1-15(2,3)10-4-6-11(7-5-10)17-9-16(21)14(20)13(19)12(18)8-22-16/h4-7,12-14,17-21H,8-9H2,1-3H3/t12-,13-,14+,16-/m1/s1 |
| InChIKey | MQOKLANHTVGOBP-HGTKMLMNSA-N |
| XLogP | 0.20 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |