C11H19NO9 — CID 169440823
(4S)-2,2,3,3,4-pentadeuterio-4-[[(3R,4S,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methylamino]pentanedioic acid (PubChem CID 169440823) has the molecular formula C11H19NO9 and a molecular weight of 314.30 g/mol. Its IUPAC name is (4S)-2,2,3,3,4-pentadeuterio-4-[[(3R,4S,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methylamino]pentanedioic acid.
| Compound Name | (4S)-2,2,3,3,4-pentadeuterio-4-[[(3R,4S,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methylamino]pentanedioic acid |
|---|---|
| PubChem CID | 169440823 |
| Molecular Formula | C11H19NO9 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | (4S)-2,2,3,3,4-pentadeuterio-4-[[(3R,4S,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methylamino]pentanedioic acid |
| SMILES | [2H]C([2H])(C(=O)O)C([2H])([2H])[C@]([2H])(NCC1(O)OC[C@@H](O)[C@H](O)[C@H]1O)C(=O)O |
| InChI | InChI=1S/C11H19NO9/c13-6-3-21-11(20,9(17)8(6)16)4-12-5(10(18)19)1-2-7(14)15/h5-6,8-9,12-13,16-17,20H,1-4H2,(H,14,15)(H,18,19)/t5-,6+,8-,9+,11?/m0/s1/i1D2,2D2,5D |
| InChIKey | RHYOFQJYHNHREU-DNGDIIFDSA-N |
| XLogP | -3.30 |
| TPSA | 176.78 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | -3.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |