C9H12Cl3NO — CID 101149803
2,2,2-trichloro-N-[[(1S)-1-methylcyclopent-2-en-1-yl]methyl]acetamide (PubChem CID 101149803) has the molecular formula C9H12Cl3NO and a molecular weight of 256.56 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[[(1S)-1-methylcyclopent-2-en-1-yl]methyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[[(1S)-1-methylcyclopent-2-en-1-yl]methyl]acetamide |
|---|---|
| PubChem CID | 101149803 |
| Molecular Formula | C9H12Cl3NO |
| Molecular Weight | 256.56 g/mol |
| Exact Mass | 255.00 |
| IUPAC Name | 2,2,2-trichloro-N-[[(1S)-1-methylcyclopent-2-en-1-yl]methyl]acetamide |
| SMILES | C[C@@]1(CNC(=O)C(Cl)(Cl)Cl)C=CCC1 |
| InChI | InChI=1S/C9H12Cl3NO/c1-8(4-2-3-5-8)6-13-7(14)9(10,11)12/h2,4H,3,5-6H2,1H3,(H,13,14)/t8-/m1/s1 |
| InChIKey | HHJVZJDNZULXDH-MRVPVSSYSA-N |
| XLogP | 2.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.56 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|