C7H9O2- — CID 23127641
1-methylcyclopent-2-ene-1-carboxylate (PubChem CID 23127641) has the molecular formula C7H9O2- and a molecular weight of 125.15 g/mol. Its IUPAC name is 1-methylcyclopent-2-ene-1-carboxylate.
| Compound Name | 1-methylcyclopent-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 23127641 |
| Molecular Formula | C7H9O2- |
| Molecular Weight | 125.15 g/mol |
| Exact Mass | 125.06 |
| IUPAC Name | 1-methylcyclopent-2-ene-1-carboxylate |
| SMILES | CC1(C(=O)[O-])C=CCC1 |
| InChI | InChI=1S/C7H10O2/c1-7(6(8)9)4-2-3-5-7/h2,4H,3,5H2,1H3,(H,8,9)/p-1 |
| InChIKey | HGSACGMRDLYHMZ-UHFFFAOYSA-M |
| XLogP | 0.09 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.15 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|