C14H25NOS — CID 101224631
S-[(1S)-1-methylcyclohex-2-en-1-yl] N,N-di(propan-2-yl)carbamothioate (PubChem CID 101224631) has the molecular formula C14H25NOS and a molecular weight of 255.43 g/mol. Its IUPAC name is S-[(1S)-1-methylcyclohex-2-en-1-yl] N,N-di(propan-2-yl)carbamothioate.
| Compound Name | S-[(1S)-1-methylcyclohex-2-en-1-yl] N,N-di(propan-2-yl)carbamothioate |
|---|---|
| PubChem CID | 101224631 |
| Molecular Formula | C14H25NOS |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | S-[(1S)-1-methylcyclohex-2-en-1-yl] N,N-di(propan-2-yl)carbamothioate |
| SMILES | CC(C)N(C(=O)S[C@]1(C)C=CCCC1)C(C)C |
| InChI | InChI=1S/C14H25NOS/c1-11(2)15(12(3)4)13(16)17-14(5)9-7-6-8-10-14/h7,9,11-12H,6,8,10H2,1-5H3/t14-/m1/s1 |
| InChIKey | RFANOFOAIGUPGH-CQSZACIVSA-N |
| XLogP | 4.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|