C16H27NOS — CID 11243004
S-[(1S)-1-prop-2-enylcyclohex-2-en-1-yl] N,N-di(propan-2-yl)carbamothioate (PubChem CID 11243004) has the molecular formula C16H27NOS and a molecular weight of 281.47 g/mol. Its IUPAC name is S-[(1S)-1-prop-2-enylcyclohex-2-en-1-yl] N,N-di(propan-2-yl)carbamothioate.
| Compound Name | S-[(1S)-1-prop-2-enylcyclohex-2-en-1-yl] N,N-di(propan-2-yl)carbamothioate |
|---|---|
| PubChem CID | 11243004 |
| Molecular Formula | C16H27NOS |
| Molecular Weight | 281.47 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | S-[(1S)-1-prop-2-enylcyclohex-2-en-1-yl] N,N-di(propan-2-yl)carbamothioate |
| SMILES | C=CC[C@]1(SC(=O)N(C(C)C)C(C)C)C=CCCC1 |
| InChI | InChI=1S/C16H27NOS/c1-6-10-16(11-8-7-9-12-16)19-15(18)17(13(2)3)14(4)5/h6,8,11,13-14H,1,7,9-10,12H2,2-5H3/t16-/m0/s1 |
| InChIKey | JKNZIIHOTMOXRA-INIZCTEOSA-N |
| XLogP | 5.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.47 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|