C22H31NOS — CID 101224639
S-[(1R)-1-[(E)-3-phenylprop-2-enyl]cyclohex-2-en-1-yl] N,N-di(propan-2-yl)carbamothioate (PubChem CID 101224639) has the molecular formula C22H31NOS and a molecular weight of 357.56 g/mol. Its IUPAC name is S-[(1R)-1-[(E)-3-phenylprop-2-enyl]cyclohex-2-en-1-yl] N,N-di(propan-2-yl)carbamothioate.
| Compound Name | S-[(1R)-1-[(E)-3-phenylprop-2-enyl]cyclohex-2-en-1-yl] N,N-di(propan-2-yl)carbamothioate |
|---|---|
| PubChem CID | 101224639 |
| Molecular Formula | C22H31NOS |
| Molecular Weight | 357.56 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | S-[(1R)-1-[(E)-3-phenylprop-2-enyl]cyclohex-2-en-1-yl] N,N-di(propan-2-yl)carbamothioate |
| SMILES | CC(C)N(C(=O)S[C@]1(C/C=C/c2ccccc2)C=CCCC1)C(C)C |
| InChI | InChI=1S/C22H31NOS/c1-18(2)23(19(3)4)21(24)25-22(15-9-6-10-16-22)17-11-14-20-12-7-5-8-13-20/h5,7-9,11-15,18-19H,6,10,16-17H2,1-4H3/b14-11+/t22-/m1/s1 |
| InChIKey | GFINEANNYHEYCD-YDYPUGOESA-N |
| XLogP | 6.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.56 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|