C14H24O — CID 136913170
(1R,3S,8aR)-3-deuterio-8a-methyl-1-propan-2-yl-1,2,3,6,7,8-hexahydroazulen-3a-ol (PubChem CID 136913170) has the molecular formula C14H24O and a molecular weight of 209.35 g/mol. Its IUPAC name is (1R,3S,8aR)-3-deuterio-8a-methyl-1-propan-2-yl-1,2,3,6,7,8-hexahydroazulen-3a-ol.
| Compound Name | (1R,3S,8aR)-3-deuterio-8a-methyl-1-propan-2-yl-1,2,3,6,7,8-hexahydroazulen-3a-ol |
|---|---|
| PubChem CID | 136913170 |
| Molecular Formula | C14H24O |
| Molecular Weight | 209.35 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | (1R,3S,8aR)-3-deuterio-8a-methyl-1-propan-2-yl-1,2,3,6,7,8-hexahydroazulen-3a-ol |
| SMILES | [2H][C@H]1C[C@H](C(C)C)[C@@]2(C)CCCC=CC12O |
| InChI | InChI=1S/C14H24O/c1-11(2)12-7-10-14(15)9-6-4-5-8-13(12,14)3/h6,9,11-12,15H,4-5,7-8,10H2,1-3H3/t12-,13-,14?/m1/s1/i10D/t10-,12+,13+,14?/m0 |
| InChIKey | XJDILHQTHPTNSM-RXQYQJTMSA-N |
| XLogP | 3.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|