C20H27NO7 — CID 54377575
benzyl (4aR,6R,7R,8R,8aS)-6-aminooxy-8-hydroxy-2,2-dimethyl-6-prop-2-enyl-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-7-carboxylate (PubChem CID 54377575) has the molecular formula C20H27NO7 and a molecular weight of 393.44 g/mol. Its IUPAC name is benzyl (4aR,6R,7R,8R,8aS)-6-aminooxy-8-hydroxy-2,2-dimethyl-6-prop-2-enyl-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-7-carboxylate.
| Compound Name | benzyl (4aR,6R,7R,8R,8aS)-6-aminooxy-8-hydroxy-2,2-dimethyl-6-prop-2-enyl-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-7-carboxylate |
|---|---|
| PubChem CID | 54377575 |
| Molecular Formula | C20H27NO7 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | benzyl (4aR,6R,7R,8R,8aS)-6-aminooxy-8-hydroxy-2,2-dimethyl-6-prop-2-enyl-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-7-carboxylate |
| SMILES | C=CC[C@]1(ON)O[C@@H]2COC(C)(C)O[C@H]2[C@H](O)[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H27NO7/c1-4-10-20(28-21)15(18(23)24-11-13-8-6-5-7-9-13)16(22)17-14(26-20)12-25-19(2,3)27-17/h4-9,14-17,22H,1,10-12,21H2,2-3H3/t14-,15+,16-,17-,20-/m1/s1 |
| InChIKey | UXQDTPICSNIBRJ-QRXRQMIZSA-N |
| XLogP | 1.42 |
| TPSA | 109.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|