C24H33NO8 — CID 11784512
[(4aR,6R,7S,8R,8aS)-2,2-dimethyl-6-pent-4-enoxy-7-(phenylmethoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate (PubChem CID 11784512) has the molecular formula C24H33NO8 and a molecular weight of 463.53 g/mol. Its IUPAC name is [(4aR,6R,7S,8R,8aS)-2,2-dimethyl-6-pent-4-enoxy-7-(phenylmethoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate.
| Compound Name | [(4aR,6R,7S,8R,8aS)-2,2-dimethyl-6-pent-4-enoxy-7-(phenylmethoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
|---|---|
| PubChem CID | 11784512 |
| Molecular Formula | C24H33NO8 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | [(4aR,6R,7S,8R,8aS)-2,2-dimethyl-6-pent-4-enoxy-7-(phenylmethoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
| SMILES | C=CCCCO[C@@H]1O[C@@H]2COC(C)(C)O[C@H]2[C@H](OC(C)=O)[C@@H]1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H33NO8/c1-5-6-10-13-28-22-19(25-23(27)29-14-17-11-8-7-9-12-17)21(31-16(2)26)20-18(32-22)15-30-24(3,4)33-20/h5,7-9,11-12,18-22H,1,6,10,13-15H2,2-4H3,(H,25,27)/t18-,19+,20-,21-,22-/m1/s1 |
| InChIKey | IUFOJJGGIXMJHS-PVIWCNJMSA-N |
| XLogP | 3.07 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|