C15H23NO8 — CID 170924028
[(4aR,7R,8R,8aS)-7-acetamido-6-acetyloxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate (PubChem CID 170924028) has the molecular formula C15H23NO8 and a molecular weight of 345.35 g/mol. Its IUPAC name is [(4aR,7R,8R,8aS)-7-acetamido-6-acetyloxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate.
| Compound Name | [(4aR,7R,8R,8aS)-7-acetamido-6-acetyloxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
|---|---|
| PubChem CID | 170924028 |
| Molecular Formula | C15H23NO8 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | [(4aR,7R,8R,8aS)-7-acetamido-6-acetyloxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
| SMILES | CC(=O)N[C@H]1C(OC(C)=O)O[C@@H]2COC(C)(C)O[C@H]2[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H23NO8/c1-7(17)16-11-13(21-8(2)18)12-10(6-20-15(4,5)24-12)23-14(11)22-9(3)19/h10-14H,6H2,1-5H3,(H,16,17)/t10-,11-,12-,13-,14?/m1/s1 |
| InChIKey | KHQYLOINKUECLZ-GNMOMJPPSA-N |
| XLogP | -0.14 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |