C19H35NO6 — CID 129428846
N-[(4aR,6R,7R,8S,8aR)-8-hydroxy-2,2-dimethyl-6-octoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide (PubChem CID 129428846) has the molecular formula C19H35NO6 and a molecular weight of 373.49 g/mol. Its IUPAC name is N-[(4aR,6R,7R,8S,8aR)-8-hydroxy-2,2-dimethyl-6-octoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide.
| Compound Name | N-[(4aR,6R,7R,8S,8aR)-8-hydroxy-2,2-dimethyl-6-octoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
|---|---|
| PubChem CID | 129428846 |
| Molecular Formula | C19H35NO6 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | N-[(4aR,6R,7R,8S,8aR)-8-hydroxy-2,2-dimethyl-6-octoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
| SMILES | CCCCCCCCO[C@@H]1O[C@@H]2COC(C)(C)O[C@@H]2[C@@H](O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C19H35NO6/c1-5-6-7-8-9-10-11-23-18-15(20-13(2)21)16(22)17-14(25-18)12-24-19(3,4)26-17/h14-18,22H,5-12H2,1-4H3,(H,20,21)/t14-,15-,16+,17+,18-/m1/s1 |
| InChIKey | JUWNSVIJWPXXPM-DFBDCSAJSA-N |
| XLogP | 2.11 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|