C15H20Cl3NO8 — CID 102595806
[(4aR,6R,7R,8R,8aS)-6-acetyloxy-2,2-dimethyl-7-[(2,2,2-trichloroacetyl)amino]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate (PubChem CID 102595806) has the molecular formula C15H20Cl3NO8 and a molecular weight of 448.68 g/mol. Its IUPAC name is [(4aR,6R,7R,8R,8aS)-6-acetyloxy-2,2-dimethyl-7-[(2,2,2-trichloroacetyl)amino]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate.
| Compound Name | [(4aR,6R,7R,8R,8aS)-6-acetyloxy-2,2-dimethyl-7-[(2,2,2-trichloroacetyl)amino]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
|---|---|
| PubChem CID | 102595806 |
| Molecular Formula | C15H20Cl3NO8 |
| Molecular Weight | 448.68 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | [(4aR,6R,7R,8R,8aS)-6-acetyloxy-2,2-dimethyl-7-[(2,2,2-trichloroacetyl)amino]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
| SMILES | CC(=O)O[C@H]1O[C@@H]2COC(C)(C)O[C@H]2[C@H](OC(C)=O)[C@H]1NC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H20Cl3NO8/c1-6(20)24-11-9(19-13(22)15(16,17)18)12(25-7(2)21)26-8-5-23-14(3,4)27-10(8)11/h8-12H,5H2,1-4H3,(H,19,22)/t8-,9-,10-,11-,12+/m1/s1 |
| InChIKey | SHDNBOXEJBNYEM-OOCWMUITSA-N |
| XLogP | 1.21 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.68 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|