C27H33NO4 — CID 101156549
tert-butyl 1-benzyl-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-5-phenylpyrrolidine-3-carboxylate (PubChem CID 101156549) has the molecular formula C27H33NO4 and a molecular weight of 435.56 g/mol. Its IUPAC name is tert-butyl 1-benzyl-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-5-phenylpyrrolidine-3-carboxylate.
| Compound Name | tert-butyl 1-benzyl-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-5-phenylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 101156549 |
| Molecular Formula | C27H33NO4 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | tert-butyl 1-benzyl-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-5-phenylpyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)/C=C/C1C(C(=O)OC(C)(C)C)CC(c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C27H33NO4/c1-5-31-25(29)17-16-23-22(26(30)32-27(2,3)4)18-24(21-14-10-7-11-15-21)28(23)19-20-12-8-6-9-13-20/h6-17,22-24H,5,18-19H2,1-4H3/b17-16+ |
| InChIKey | WAIRRAXSFQEQIM-WUKNDPDISA-N |
| XLogP | 5.08 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|