C26H27NO6 — CID 10575489
trans-1-O'-benzyl 1-O-methyl (1S,2R)-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]cyclopropane-1,1-dicarboxylate (PubChem CID 10575489) has the molecular formula C26H27NO6 and a molecular weight of 449.50 g/mol. Its IUPAC name is trans-1-O'-benzyl 1-O-methyl (1S,2R)-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]cyclopropane-1,1-dicarboxylate.
| Compound Name | trans-1-O'-benzyl 1-O-methyl (1S,2R)-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10575489 |
| Molecular Formula | C26H27NO6 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | trans-1-O'-benzyl 1-O-methyl (1S,2R)-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]cyclopropane-1,1-dicarboxylate |
| SMILES | COC(=O)[C@]1(C(=O)OCc2ccccc2)C[C@@H]1c1cn(C(=O)OC(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C26H27NO6/c1-25(2,3)33-24(30)27-15-19(18-12-8-9-13-21(18)27)20-14-26(20,22(28)31-4)23(29)32-16-17-10-6-5-7-11-17/h5-13,15,20H,14,16H2,1-4H3/t20-,26+/m1/s1 |
| InChIKey | CNXQADAKJUQYLG-IBVKSMDESA-N |
| XLogP | 4.81 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|