C31H38O8 — CID 11353190
diethyl 2-[(3R,4S)-4-[2-[(4-methoxyphenyl)methoxy]ethyl]-6-oxo-3-(phenylmethoxymethyl)cyclohexen-1-yl]propanedioate (PubChem CID 11353190) has the molecular formula C31H38O8 and a molecular weight of 538.64 g/mol. Its IUPAC name is diethyl 2-[(3R,4S)-4-[2-[(4-methoxyphenyl)methoxy]ethyl]-6-oxo-3-(phenylmethoxymethyl)cyclohexen-1-yl]propanedioate.
| Compound Name | diethyl 2-[(3R,4S)-4-[2-[(4-methoxyphenyl)methoxy]ethyl]-6-oxo-3-(phenylmethoxymethyl)cyclohexen-1-yl]propanedioate |
|---|---|
| PubChem CID | 11353190 |
| Molecular Formula | C31H38O8 |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | diethyl 2-[(3R,4S)-4-[2-[(4-methoxyphenyl)methoxy]ethyl]-6-oxo-3-(phenylmethoxymethyl)cyclohexen-1-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C1=C[C@H](COCc2ccccc2)[C@@H](CCOCc2ccc(OC)cc2)CC1=O |
| InChI | InChI=1S/C31H38O8/c1-4-38-30(33)29(31(34)39-5-2)27-17-25(21-37-20-22-9-7-6-8-10-22)24(18-28(27)32)15-16-36-19-23-11-13-26(35-3)14-12-23/h6-14,17,24-25,29H,4-5,15-16,18-21H2,1-3H3/t24-,25+/m0/s1 |
| InChIKey | CNFJOVFJVHARMD-LOSJGSFVSA-N |
| XLogP | 4.69 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|