C16H20O4S — CID 101028113
ethyl (2R,3R)-5-oxo-3-(phenylmethoxymethyl)thiane-2-carboxylate (PubChem CID 101028113) has the molecular formula C16H20O4S and a molecular weight of 308.40 g/mol. Its IUPAC name is ethyl (2R,3R)-5-oxo-3-(phenylmethoxymethyl)thiane-2-carboxylate.
| Compound Name | ethyl (2R,3R)-5-oxo-3-(phenylmethoxymethyl)thiane-2-carboxylate |
|---|---|
| PubChem CID | 101028113 |
| Molecular Formula | C16H20O4S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | ethyl (2R,3R)-5-oxo-3-(phenylmethoxymethyl)thiane-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1SCC(=O)C[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C16H20O4S/c1-2-20-16(18)15-13(8-14(17)11-21-15)10-19-9-12-6-4-3-5-7-12/h3-7,13,15H,2,8-11H2,1H3/t13-,15-/m1/s1 |
| InChIKey | ILAQHIHFUBUVRL-UKRRQHHQSA-N |
| XLogP | 2.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |