C16H20O3S — CID 101028101
ethyl (2S,6S)-6-(phenylmethoxymethyl)-3,6-dihydro-2H-thiopyran-2-carboxylate (PubChem CID 101028101) has the molecular formula C16H20O3S and a molecular weight of 292.40 g/mol. Its IUPAC name is ethyl (2S,6S)-6-(phenylmethoxymethyl)-3,6-dihydro-2H-thiopyran-2-carboxylate.
| Compound Name | ethyl (2S,6S)-6-(phenylmethoxymethyl)-3,6-dihydro-2H-thiopyran-2-carboxylate |
|---|---|
| PubChem CID | 101028101 |
| Molecular Formula | C16H20O3S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | ethyl (2S,6S)-6-(phenylmethoxymethyl)-3,6-dihydro-2H-thiopyran-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC=C[C@@H](COCc2ccccc2)S1 |
| InChI | InChI=1S/C16H20O3S/c1-2-19-16(17)15-10-6-9-14(20-15)12-18-11-13-7-4-3-5-8-13/h3-9,14-15H,2,10-12H2,1H3/t14-,15-/m0/s1 |
| InChIKey | HOUHNZMYZPIPPX-GJZGRUSLSA-N |
| XLogP | 3.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|