C14H16O2 — CID 101403623
(E)-5-[(2R,3R)-3-methyloxiran-2-yl]-1-phenylpent-2-en-1-one (PubChem CID 101403623) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is (E)-5-[(2R,3R)-3-methyloxiran-2-yl]-1-phenylpent-2-en-1-one.
| Compound Name | (E)-5-[(2R,3R)-3-methyloxiran-2-yl]-1-phenylpent-2-en-1-one |
|---|---|
| PubChem CID | 101403623 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | (E)-5-[(2R,3R)-3-methyloxiran-2-yl]-1-phenylpent-2-en-1-one |
| SMILES | C[C@H]1O[C@@H]1CC/C=C/C(=O)c1ccccc1 |
| InChI | InChI=1S/C14H16O2/c1-11-14(16-11)10-6-5-9-13(15)12-7-3-2-4-8-12/h2-5,7-9,11,14H,6,10H2,1H3/b9-5+/t11-,14-/m1/s1 |
| InChIKey | VCYJTESKXFOOEV-VUQQZHKESA-N |
| XLogP | 2.99 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|