C27H34O4Si — CID 11576022
[(4R,6R)-6-[tert-butyl(diphenyl)silyl]oxy-8-oxooct-1-en-4-yl] prop-2-enoate (PubChem CID 11576022) has the molecular formula C27H34O4Si and a molecular weight of 450.65 g/mol. Its IUPAC name is [(4R,6R)-6-[tert-butyl(diphenyl)silyl]oxy-8-oxooct-1-en-4-yl] prop-2-enoate.
| Compound Name | [(4R,6R)-6-[tert-butyl(diphenyl)silyl]oxy-8-oxooct-1-en-4-yl] prop-2-enoate |
|---|---|
| PubChem CID | 11576022 |
| Molecular Formula | C27H34O4Si |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | [(4R,6R)-6-[tert-butyl(diphenyl)silyl]oxy-8-oxooct-1-en-4-yl] prop-2-enoate |
| SMILES | C=CC[C@H](C[C@H](CC=O)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC(=O)C=C |
| InChI | InChI=1S/C27H34O4Si/c1-6-14-22(30-26(29)7-2)21-23(19-20-28)31-32(27(3,4)5,24-15-10-8-11-16-24)25-17-12-9-13-18-25/h6-13,15-18,20,22-23H,1-2,14,19,21H2,3-5H3/t22-,23+/m1/s1 |
| InChIKey | BOAWLNSOAOHDQR-PKTZIBPZSA-N |
| XLogP | 4.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|